About 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine
3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine (PubChem CID 135731706) has the molecular formula C24H36N10
and a molecular weight of 464.62 g/mol. Its IUPAC name is 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine.
Molecular Properties
| Compound Name | 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine |
| PubChem CID | 135731706 |
| Molecular Formula | C24H36N10 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine |
| SMILES | CCCCn1cn/c(=N\CC)c2[nH]c(C3CC3)nc21.CCCn1cn/c(=N\CC)c2[nH]cnc21 |
| InChI | InChI=1S/C14H21N5.C10H15N5/c1-3-5-8-19-9-16-13(15-4-2)11-14(19)18-12(17-11)10-6-7-10;1-3-5-15-7-14-9(11-4-2)8-10(15)13-6-12-8/h9-10H,3-8H2,1-2H3,(H,17,18);6-7H,3-5H2,1-2H3,(H,12,13)/b15-13-;11-9- |
| InChIKey | HFDNGKHCZFEXNM-ZCTHFWHPSA-N |
| XLogP | 3.45 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine?
The IUPAC name of 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine (CID 135731706) is 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine.
What is the SMILES notation for 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine?
The canonical SMILES for 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine is CCCCn1cn/c(=N\CC)c2[nH]c(C3CC3)nc21.CCCn1cn/c(=N\CC)c2[nH]cnc21.
What is the InChIKey of 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine?
The InChIKey is HFDNGKHCZFEXNM-ZCTHFWHPSA-N. The full InChI is InChI=1S/C14H21N5.C10H15N5/c1-3-5-8-19-9-16-13(15-4-2)11-14(19)18-12(17-11)10-6-7-10;1-3-5-15-7-14-9(11-4-2)8-10(15)13-6-12-8/h9-10H,3-8H2,1-2H3,(H,17,18);6-7H,3-5H2,1-2H3,(H,12,13)/b15-13-;11-9-.
What are the key properties of 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine?
3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine has a molecular weight of 464.62 g/mol, XLogP of 3.45, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-8-cyclopropyl-N-ethyl-7H-purin-6-imine;N-ethyl-3-propyl-7H-purin-6-imine is sourced from PubChem (CID 135731706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).