About 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one
3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 135731742) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 135731742 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2ccccc2O)=NN1 |
| InChI | InChI=1S/C10H10N2O2/c13-9-4-2-1-3-7(9)8-5-6-10(14)12-11-8/h1-4,13H,5-6H2,(H,12,14) |
| InChIKey | ODMBJAQJBFQMEV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one (CID 135731742) is 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one is O=C1CCC(c2ccccc2O)=NN1.
What is the InChIKey of 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is ODMBJAQJBFQMEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c13-9-4-2-1-3-7(9)8-5-6-10(14)12-11-8/h1-4,13H,5-6H2,(H,12,14).
What are the key properties of 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 190.20 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 135731742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).