C13H10N3OS3- — CID 135733013
3-(4-ethylphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidine-5-thiolate (PubChem CID 135733013) has the molecular formula C13H10N3OS3- and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidine-5-thiolate.
| Compound Name | 3-(4-ethylphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidine-5-thiolate |
|---|---|
| PubChem CID | 135733013 |
| Molecular Formula | C13H10N3OS3- |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 3-(4-ethylphenyl)-7-oxo-2-sulfanylidene-6H-[1,3]thiazolo[4,5-d]pyrimidine-5-thiolate |
| SMILES | CCc1ccc(-n2c(=S)sc3c(=O)[nH]c([S-])nc32)cc1 |
| InChI | InChI=1S/C13H11N3OS3/c1-2-7-3-5-8(6-4-7)16-10-9(20-13(16)19)11(17)15-12(18)14-10/h3-6H,2H2,1H3,(H2,14,15,17,18)/p-1 |
| InChIKey | AMIIEVLVAJBSLE-UHFFFAOYSA-M |
| XLogP | 2.97 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|