C16H18N3O2S+ — CID 135733566
[[amino(pyridin-1-ium-3-yl)methylidene]amino] (2S)-2-(4-methylphenyl)sulfanylpropanoate (PubChem CID 135733566) has the molecular formula C16H18N3O2S+ and a molecular weight of 316.41 g/mol. Its IUPAC name is [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2S)-2-(4-methylphenyl)sulfanylpropanoate.
| Compound Name | [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2S)-2-(4-methylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 135733566 |
| Molecular Formula | C16H18N3O2S+ |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [[amino(pyridin-1-ium-3-yl)methylidene]amino] (2S)-2-(4-methylphenyl)sulfanylpropanoate |
| SMILES | Cc1ccc(S[C@@H](C)C(=O)ON=C(N)c2ccc[nH+]c2)cc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-11-5-7-14(8-6-11)22-12(2)16(20)21-19-15(17)13-4-3-9-18-10-13/h3-10,12H,1-2H3,(H2,17,19)/p+1/t12-/m0/s1 |
| InChIKey | LWLFNXMAXGJWKI-LBPRGKRZSA-O |
| XLogP | 2.15 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|