C16H25N5O3 — CID 135733645
1-(6-isocyanato-2,4,4-trimethylhexyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea (PubChem CID 135733645) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(6-isocyanato-2,4,4-trimethylhexyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea.
| Compound Name | 1-(6-isocyanato-2,4,4-trimethylhexyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
|---|---|
| PubChem CID | 135733645 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-(6-isocyanato-2,4,4-trimethylhexyl)-3-(4-methyl-6-oxo-1H-pyrimidin-2-yl)urea |
| SMILES | Cc1cc(=O)[nH]c(NC(=O)NCC(C)CC(C)(C)CCN=C=O)n1 |
| InChI | InChI=1S/C16H25N5O3/c1-11(8-16(3,4)5-6-17-10-22)9-18-15(24)21-14-19-12(2)7-13(23)20-14/h7,11H,5-6,8-9H2,1-4H3,(H3,18,19,20,21,23,24) |
| InChIKey | WOQVNGIOWMVFLO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|