About 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde
4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde (PubChem CID 135733724) has the molecular formula C11H13N5O3
and a molecular weight of 263.26 g/mol. Its IUPAC name is 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde |
| PubChem CID | 135733724 |
| Molecular Formula | C11H13N5O3 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(n2c(=O)[nH]c3c(=O)[nH]cnc32)CC1 |
| InChI | InChI=1S/C11H13N5O3/c17-6-15-3-1-7(2-4-15)16-9-8(14-11(16)19)10(18)13-5-12-9/h5-7H,1-4H2,(H,14,19)(H,12,13,18) |
| InChIKey | GAHRYOHXKXBWNN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde?
The IUPAC name of 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde (CID 135733724) is 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde.
What is the SMILES notation for 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde?
The canonical SMILES for 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde is O=CN1CCC(n2c(=O)[nH]c3c(=O)[nH]cnc32)CC1.
What is the InChIKey of 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde?
The InChIKey is GAHRYOHXKXBWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O3/c17-6-15-3-1-7(2-4-15)16-9-8(14-11(16)19)10(18)13-5-12-9/h5-7H,1-4H2,(H,14,19)(H,12,13,18).
What are the key properties of 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde?
4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde has a molecular weight of 263.26 g/mol, XLogP of -0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,8-dioxo-1,7-dihydropurin-9-yl)piperidine-1-carbaldehyde is sourced from PubChem (CID 135733724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).