C10H17N7O3 — CID 135733730
(NZ)-N-[5-methyl-1-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3,5-triazinan-2-ylidene]nitramide (PubChem CID 135733730) has the molecular formula C10H17N7O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is (NZ)-N-[5-methyl-1-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3,5-triazinan-2-ylidene]nitramide.
| Compound Name | (NZ)-N-[5-methyl-1-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3,5-triazinan-2-ylidene]nitramide |
|---|---|
| PubChem CID | 135733730 |
| Molecular Formula | C10H17N7O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (NZ)-N-[5-methyl-1-[(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl]-1,3,5-triazinan-2-ylidene]nitramide |
| SMILES | CC(C)c1noc(CN2CN(C)CN/C2=N/[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H17N7O3/c1-7(2)9-12-8(20-14-9)4-16-6-15(3)5-11-10(16)13-17(18)19/h7H,4-6H2,1-3H3,(H,11,13) |
| InChIKey | ZINKRCXOCPEVQV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|