C28H33N3O4 — CID 135733743
2-(6-hydroxy-2,3,4-trimethylphenyl)-3,4,5-trimethyl-6-[(2,3,4,5-tetramethyl-6-nitrophenyl)diazenyl]phenol (PubChem CID 135733743) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-(6-hydroxy-2,3,4-trimethylphenyl)-3,4,5-trimethyl-6-[(2,3,4,5-tetramethyl-6-nitrophenyl)diazenyl]phenol.
| Compound Name | 2-(6-hydroxy-2,3,4-trimethylphenyl)-3,4,5-trimethyl-6-[(2,3,4,5-tetramethyl-6-nitrophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 135733743 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-(6-hydroxy-2,3,4-trimethylphenyl)-3,4,5-trimethyl-6-[(2,3,4,5-tetramethyl-6-nitrophenyl)diazenyl]phenol |
| SMILES | Cc1cc(O)c(-c2c(C)c(C)c(C)c(/N=N/c3c(C)c(C)c(C)c(C)c3[N+](=O)[O-])c2O)c(C)c1C |
| InChI | InChI=1S/C28H33N3O4/c1-12-11-22(32)23(17(6)13(12)2)24-18(7)16(5)20(9)26(28(24)33)30-29-25-19(8)14(3)15(4)21(10)27(25)31(34)35/h11,32-33H,1-10H3/b30-29+ |
| InChIKey | IARHKVKLHMEYLU-QVIHXGFCSA-N |
| XLogP | 8.17 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|