About (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate
(4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate (PubChem CID 135734893) has the molecular formula C18H16N2O4
and a molecular weight of 324.34 g/mol. Its IUPAC name is (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate.
Molecular Properties
| Compound Name | (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate |
| PubChem CID | 135734893 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H16N2O4/c1-2-23-15-10-6-4-8-13(15)18(22)24-11-16-19-14-9-5-3-7-12(14)17(21)20-16/h3-10H,2,11H2,1H3,(H,19,20,21) |
| InChIKey | ZNKMTPKYWRDLMA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate?
The IUPAC name of (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate (CID 135734893) is (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate.
What is the SMILES notation for (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate?
The canonical SMILES for (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate is CCOc1ccccc1C(=O)OCc1nc2ccccc2c(=O)[nH]1.
What is the InChIKey of (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate?
The InChIKey is ZNKMTPKYWRDLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-2-23-15-10-6-4-8-13(15)18(22)24-11-16-19-14-9-5-3-7-12(14)17(21)20-16/h3-10H,2,11H2,1H3,(H,19,20,21).
What are the key properties of (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate?
(4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate has a molecular weight of 324.34 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-quinazolin-2-yl)methyl 2-ethoxybenzoate is sourced from PubChem (CID 135734893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).