C21H23N3O2 — CID 135734969
2-[(1-adamantylamino)methyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one (PubChem CID 135734969) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[(1-adamantylamino)methyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(1-adamantylamino)methyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135734969 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[(1-adamantylamino)methyl]-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNC23CC4CC(CC(C4)C2)C3)nc2c1oc1ccccc12 |
| InChI | InChI=1S/C21H23N3O2/c25-20-19-18(15-3-1-2-4-16(15)26-19)23-17(24-20)11-22-21-8-12-5-13(9-21)7-14(6-12)10-21/h1-4,12-14,22H,5-11H2,(H,23,24,25) |
| InChIKey | IUQJOYDMYJDAQL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |