C24H31N3O4 — CID 135735115
2-[[3-(2,5-dimethylphenoxy)propyl-ethylamino]methyl]-6,7-dimethoxy-3H-quinazolin-4-one (PubChem CID 135735115) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[[3-(2,5-dimethylphenoxy)propyl-ethylamino]methyl]-6,7-dimethoxy-3H-quinazolin-4-one.
| Compound Name | 2-[[3-(2,5-dimethylphenoxy)propyl-ethylamino]methyl]-6,7-dimethoxy-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135735115 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-[[3-(2,5-dimethylphenoxy)propyl-ethylamino]methyl]-6,7-dimethoxy-3H-quinazolin-4-one |
| SMILES | CCN(CCCOc1cc(C)ccc1C)Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H31N3O4/c1-6-27(10-7-11-31-20-12-16(2)8-9-17(20)3)15-23-25-19-14-22(30-5)21(29-4)13-18(19)24(28)26-23/h8-9,12-14H,6-7,10-11,15H2,1-5H3,(H,25,26,28) |
| InChIKey | GQHVTMYFQOHVQU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|