About 2-(2,4,7-triaminopteridin-6-yl)phenol
2-(2,4,7-triaminopteridin-6-yl)phenol (PubChem CID 135735591) has the molecular formula C12H11N7O
and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-(2,4,7-triaminopteridin-6-yl)phenol.
Molecular Properties
| Compound Name | 2-(2,4,7-triaminopteridin-6-yl)phenol |
| PubChem CID | 135735591 |
| Molecular Formula | C12H11N7O |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-(2,4,7-triaminopteridin-6-yl)phenol |
| SMILES | Nc1nc(N)c2nc(-c3ccccc3O)c(N)nc2n1 |
| InChI | InChI=1S/C12H11N7O/c13-9-7(5-3-1-2-4-6(5)20)16-8-10(14)18-12(15)19-11(8)17-9/h1-4,20H,(H6,13,14,15,17,18,19) |
| InChIKey | MMLQUJJYPKLMBP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(2,4,7-triaminopteridin-6-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,7-triaminopteridin-6-yl)phenol?
The IUPAC name of 2-(2,4,7-triaminopteridin-6-yl)phenol (CID 135735591) is 2-(2,4,7-triaminopteridin-6-yl)phenol.
What is the SMILES notation for 2-(2,4,7-triaminopteridin-6-yl)phenol?
The canonical SMILES for 2-(2,4,7-triaminopteridin-6-yl)phenol is Nc1nc(N)c2nc(-c3ccccc3O)c(N)nc2n1.
What is the InChIKey of 2-(2,4,7-triaminopteridin-6-yl)phenol?
The InChIKey is MMLQUJJYPKLMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N7O/c13-9-7(5-3-1-2-4-6(5)20)16-8-10(14)18-12(15)19-11(8)17-9/h1-4,20H,(H6,13,14,15,17,18,19).
What are the key properties of 2-(2,4,7-triaminopteridin-6-yl)phenol?
2-(2,4,7-triaminopteridin-6-yl)phenol has a molecular weight of 269.27 g/mol, XLogP of 0.54, 1 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,7-triaminopteridin-6-yl)phenol is sourced from PubChem (CID 135735591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).