C18H25FN4O2S — CID 135735966
N-[2-(4-ethylpiperazin-1-yl)ethyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine (PubChem CID 135735966) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)ethyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135735966 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)ethyl]-5-(4-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazol-3-imine |
| SMILES | CCN1CCN(CC/N=C2\NS(=O)(=O)C(c3ccc(F)cc3)=C2C)CC1 |
| InChI | InChI=1S/C18H25FN4O2S/c1-3-22-10-12-23(13-11-22)9-8-20-18-14(2)17(26(24,25)21-18)15-4-6-16(19)7-5-15/h4-7H,3,8-13H2,1-2H3,(H,20,21) |
| InChIKey | GIOYDTQQVKFNOC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|