C23H20N2O3 — CID 135736502
(2E)-2-[(E)-(3-ethoxy-2-hydroxyphenyl)methylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 135736502) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is (2E)-2-[(E)-(3-ethoxy-2-hydroxyphenyl)methylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | (2E)-2-[(E)-(3-ethoxy-2-hydroxyphenyl)methylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 135736502 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (2E)-2-[(E)-(3-ethoxy-2-hydroxyphenyl)methylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | CCOc1cccc(/C=N/N=C(/C(=O)c2ccccc2)c2ccccc2)c1O |
| InChI | InChI=1S/C23H20N2O3/c1-2-28-20-15-9-14-19(22(20)26)16-24-25-21(17-10-5-3-6-11-17)23(27)18-12-7-4-8-13-18/h3-16,26H,2H2,1H3/b24-16+,25-21+ |
| InChIKey | VUMSGOUTNRAJBF-ADGWQJBRSA-N |
| XLogP | 4.50 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|