C13H15N5O — CID 135737402
N-[(2-methoxycyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine (PubChem CID 135737402) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is N-[(2-methoxycyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine.
| Compound Name | N-[(2-methoxycyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine |
|---|---|
| PubChem CID | 135737402 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-[(2-methoxycyclohexa-1,4-dien-1-yl)methyl]-3,5-dihydropurin-6-imine |
| SMILES | COC1=C(C/N=C2\N=CNC3=NC=NC32)CC=CC1 |
| InChI | InChI=1S/C13H15N5O/c1-19-10-5-3-2-4-9(10)6-14-12-11-13(16-7-15-11)18-8-17-12/h2-3,7-8,11H,4-6H2,1H3,(H,14,15,16,17,18) |
| InChIKey | LXSNYSOQODCBNP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|