C6H8AgN4O+ — CID 135737558
silver 7-methyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol (PubChem CID 135737558) has the molecular formula C6H8AgN4O+ and a molecular weight of 260.02 g/mol. Its IUPAC name is silver 7-methyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol.
| Compound Name | silver 7-methyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol |
|---|---|
| PubChem CID | 135737558 |
| Molecular Formula | C6H8AgN4O+ |
| Molecular Weight | 260.02 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | silver 7-methyl-4H-[1,2,4]triazolo[1,5-a]pyrimidin-7-ol |
| SMILES | CC1(O)C=CNc2ncnn21.[Ag+] |
| InChI | InChI=1S/C6H8N4O.Ag/c1-6(11)2-3-7-5-8-4-9-10(5)6;/h2-4,11H,1H3,(H,7,8,9);/q;+1 |
| InChIKey | WEDPSNOHHDWLGS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.02 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |