C7H9N3O — CID 135738618
6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one (PubChem CID 135738618) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one.
| Compound Name | 6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135738618 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 6,7,8,9-tetrahydropyrimido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1ccnc2n1CCCN2 |
| InChI | InChI=1S/C7H9N3O/c11-6-2-4-9-7-8-3-1-5-10(6)7/h2,4H,1,3,5H2,(H,8,9) |
| InChIKey | QMJBSXGXBOBMPC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |