About 6-Methyl-2-selenouracil
6-Methyl-2-selenouracil (PubChem CID 135738686) has the molecular formula C5H5N2OSe
and a molecular weight of 188.07 g/mol.
Molecular Properties
| Compound Name | 6-Methyl-2-selenouracil |
| PubChem CID | 135738686 |
| Molecular Formula | C5H5N2OSe |
| Molecular Weight | 188.07 g/mol |
| Exact Mass | 188.96 |
| IUPAC Name | — |
| SMILES | Cc1cc(=O)[nH]c([Se])n1 |
| InChI | InChI=1S/C5H5N2OSe/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H,6,7,8) |
| InChIKey | IVEONZIEHVAPFE-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.07 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-Methyl-2-selenouracil with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-Methyl-2-selenouracil?
The IUPAC name of 6-Methyl-2-selenouracil (CID 135738686) is not available.
What is the SMILES notation for 6-Methyl-2-selenouracil?
The canonical SMILES for 6-Methyl-2-selenouracil is Cc1cc(=O)[nH]c([Se])n1.
What is the InChIKey of 6-Methyl-2-selenouracil?
The InChIKey is IVEONZIEHVAPFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N2OSe/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H,6,7,8).
What are the key properties of 6-Methyl-2-selenouracil?
6-Methyl-2-selenouracil has a molecular weight of 188.07 g/mol, XLogP of -1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-Methyl-2-selenouracil is sourced from PubChem (CID 135738686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).