C11H11BrO5 — CID 135741131
2-[2-(2-bromopropanoyl)-4-hydroxyphenyl]-2-hydroxyacetic acid (PubChem CID 135741131) has the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. Its IUPAC name is 2-[2-(2-bromopropanoyl)-4-hydroxyphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(2-bromopropanoyl)-4-hydroxyphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 135741131 |
| Molecular Formula | C11H11BrO5 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 2-[2-(2-bromopropanoyl)-4-hydroxyphenyl]-2-hydroxyacetic acid |
| SMILES | CC(Br)C(=O)c1cc(O)ccc1C(O)C(=O)O |
| InChI | InChI=1S/C11H11BrO5/c1-5(12)9(14)8-4-6(13)2-3-7(8)10(15)11(16)17/h2-5,10,13,15H,1H3,(H,16,17) |
| InChIKey | UOHPTHYBBUMLPS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|