About 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one
5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (PubChem CID 135741903) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| PubChem CID | 135741903 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1COC2 |
| InChI | InChI=1S/C6H6N2O2/c9-6-4-1-10-2-5(4)7-3-8-6/h3H,1-2H2,(H,7,8,9) |
| InChIKey | ZQTIECFDGXRNRH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The IUPAC name of 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (CID 135741903) is 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is O=c1[nH]cnc2c1COC2.
What is the InChIKey of 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The InChIKey is ZQTIECFDGXRNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c9-6-4-1-10-2-5(4)7-3-8-6/h3H,1-2H2,(H,7,8,9).
What are the key properties of 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one has a molecular weight of 138.13 g/mol, XLogP of -0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 135741903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).