About 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea
1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea (PubChem CID 135742005) has the molecular formula C20H15N3O2S
and a molecular weight of 361.43 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea |
| PubChem CID | 135742005 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H15N3O2S/c24-17-11-10-14(22-20(25)21-13-6-2-1-3-7-13)12-15(17)19-23-16-8-4-5-9-18(16)26-19/h1-12,24H,(H2,21,22,25) |
| InChIKey | HKRMPJVDMMMYOC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea?
The IUPAC name of 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea (CID 135742005) is 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea.
What is the SMILES notation for 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea?
The canonical SMILES for 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea is O=C(Nc1ccccc1)Nc1ccc(O)c(-c2nc3ccccc3s2)c1.
What is the InChIKey of 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea?
The InChIKey is HKRMPJVDMMMYOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O2S/c24-17-11-10-14(22-20(25)21-13-6-2-1-3-7-13)12-15(17)19-23-16-8-4-5-9-18(16)26-19/h1-12,24H,(H2,21,22,25).
What are the key properties of 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea?
1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea has a molecular weight of 361.43 g/mol, XLogP of 5.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-3-phenylurea is sourced from PubChem (CID 135742005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).