About 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one
7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one (PubChem CID 135743546) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| PubChem CID | 135743546 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=c1cc(O)n2nccc2[nH]1 |
| InChI | InChI=1S/C6H5N3O2/c10-5-3-6(11)9-4(8-5)1-2-7-9/h1-3,11H,(H,8,10) |
| InChIKey | SLHCRNWCKCTZMF-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The IUPAC name of 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one (CID 135743546) is 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one.
What is the SMILES notation for 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The canonical SMILES for 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one is O=c1cc(O)n2nccc2[nH]1.
What is the InChIKey of 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one?
The InChIKey is SLHCRNWCKCTZMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c10-5-3-6(11)9-4(8-5)1-2-7-9/h1-3,11H,(H,8,10).
What are the key properties of 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one?
7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one has a molecular weight of 151.12 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4H-pyrazolo[1,5-a]pyrimidin-5-one is sourced from PubChem (CID 135743546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).