C28H27N5O7 — CID 135743911
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(1R,2S,3S,4R)-2,3,4-trihydroxy-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl]amino]-1H-purin-6-one (PubChem CID 135743911) has the molecular formula C28H27N5O7 and a molecular weight of 545.55 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(1R,2S,3S,4R)-2,3,4-trihydroxy-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl]amino]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(1R,2S,3S,4R)-2,3,4-trihydroxy-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl]amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 135743911 |
| Molecular Formula | C28H27N5O7 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[[(1R,2S,3S,4R)-2,3,4-trihydroxy-1,2,3,4-tetrahydrobenzo[a]anthracen-1-yl]amino]-1H-purin-6-one |
| SMILES | O=c1[nH]c(N[C@@H]2c3c(ccc4cc5ccccc5cc34)[C@@H](O)[C@H](O)[C@H]2O)nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C28H27N5O7/c34-10-18-17(35)9-19(40-18)33-11-29-22-26(33)31-28(32-27(22)39)30-21-20-15(23(36)25(38)24(21)37)6-5-14-7-12-3-1-2-4-13(12)8-16(14)20/h1-8,11,17-19,21,23-25,34-38H,9-10H2,(H2,30,31,32,39)/t17-,18+,19+,21+,23+,24-,25-/m0/s1 |
| InChIKey | WTNFKEWYHNZKRS-JQPNOIQESA-N |
| XLogP | 0.99 |
| TPSA | 185.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|