C9H12N4O2 — CID 135743939
(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)urea (PubChem CID 135743939) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is (4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)urea.
| Compound Name | (4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)urea |
|---|---|
| PubChem CID | 135743939 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)urea |
| SMILES | NC(=O)Nc1nc2c(c(=O)[nH]1)CCCC2 |
| InChI | InChI=1S/C9H12N4O2/c10-8(15)13-9-11-6-4-2-1-3-5(6)7(14)12-9/h1-4H2,(H4,10,11,12,13,14,15) |
| InChIKey | KYAXNNQKTOQEDF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |