C6H7N9 — CID 135744096
4-(1,2,4-triazin-3-yldiazenyl)-1H-pyrazole-3,5-diamine (PubChem CID 135744096) has the molecular formula C6H7N9 and a molecular weight of 205.19 g/mol. Its IUPAC name is 4-(1,2,4-triazin-3-yldiazenyl)-1H-pyrazole-3,5-diamine.
| Compound Name | 4-(1,2,4-triazin-3-yldiazenyl)-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135744096 |
| Molecular Formula | C6H7N9 |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.08 |
| IUPAC Name | 4-(1,2,4-triazin-3-yldiazenyl)-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1nccnn1 |
| InChI | InChI=1S/C6H7N9/c7-4-3(5(8)13-12-4)11-15-6-9-1-2-10-14-6/h1-2H,(H5,7,8,12,13)/b15-11+ |
| InChIKey | BPNMWGLLHFFYQU-RVDMUPIBSA-N |
| XLogP | 0.17 |
| TPSA | 144.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|