C11H8F4N6O2 — CID 135744098
4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135744098) has the molecular formula C11H8F4N6O2 and a molecular weight of 332.22 g/mol. Its IUPAC name is 4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)diazenyl]-1H-pyrazole-3,5-diamine.
| Compound Name | 4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)diazenyl]-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 135744098 |
| Molecular Formula | C11H8F4N6O2 |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 4-[(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C11H8F4N6O2/c12-10(13)11(14,15)23-6-3-4(1-2-5(6)22-10)18-19-7-8(16)20-21-9(7)17/h1-3H,(H5,16,17,20,21)/b19-18+ |
| InChIKey | PXZUKQZBFLDUMA-VHEBQXMUSA-N |
| XLogP | 2.95 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|