About 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine
4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine (PubChem CID 135744103) has the molecular formula C8H8ClN7
and a molecular weight of 237.65 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine |
| PubChem CID | 135744103 |
| Molecular Formula | C8H8ClN7 |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine |
| SMILES | Nc1n[nH]c(N)c1/N=N/c1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H8ClN7/c9-5-2-1-4(3-12-5)13-14-6-7(10)15-16-8(6)11/h1-3H,(H5,10,11,15,16)/b14-13+ |
| InChIKey | FUZXNJPCNUMJPC-BUHFOSPRSA-N |
| XLogP | 2.04 |
| TPSA | 118.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
The IUPAC name of 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine (CID 135744103) is 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine.
What is the SMILES notation for 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
The canonical SMILES for 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine is Nc1n[nH]c(N)c1/N=N/c1ccc(Cl)nc1.
What is the InChIKey of 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
The InChIKey is FUZXNJPCNUMJPC-BUHFOSPRSA-N. The full InChI is InChI=1S/C8H8ClN7/c9-5-2-1-4(3-12-5)13-14-6-7(10)15-16-8(6)11/h1-3H,(H5,10,11,15,16)/b14-13+.
What are the key properties of 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine?
4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine has a molecular weight of 237.65 g/mol, XLogP of 2.04, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-3-pyridinyl)diazenyl]-1H-pyrazole-3,5-diamine is sourced from PubChem (CID 135744103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).