About (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine
(1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine (PubChem CID 135744187) has the molecular formula C13H14N4
and a molecular weight of 226.28 g/mol. Its IUPAC name is (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine.
Molecular Properties
| Compound Name | (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine |
| PubChem CID | 135744187 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine |
| SMILES | Cc1nc2ccc3ncc(CN)c3c2c(C)[nH]1 |
| InChI | InChI=1S/C13H14N4/c1-7-12-11(17-8(2)16-7)4-3-10-13(12)9(5-14)6-15-10/h3-4,6H,5,14H2,1-2H3,(H,16,17) |
| InChIKey | YQGCEMOYVLOVSZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine?
The IUPAC name of (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine (CID 135744187) is (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine.
What is the SMILES notation for (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine?
The canonical SMILES for (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine is Cc1nc2ccc3ncc(CN)c3c2c(C)[nH]1.
What is the InChIKey of (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine?
The InChIKey is YQGCEMOYVLOVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4/c1-7-12-11(17-8(2)16-7)4-3-10-13(12)9(5-14)6-15-10/h3-4,6H,5,14H2,1-2H3,(H,16,17).
What are the key properties of (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine?
(1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine has a molecular weight of 226.28 g/mol, XLogP of 2.19, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethyl-2H-pyrrolo[3,2-f]quinazolin-9-yl)methanamine is sourced from PubChem (CID 135744187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).