C12H13N5 — CID 135744188
5,6-dimethyl-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine (PubChem CID 135744188) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 5,6-dimethyl-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine.
| Compound Name | 5,6-dimethyl-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
|---|---|
| PubChem CID | 135744188 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5,6-dimethyl-4H-pyrrolo[3,2-f]quinazoline-1,3-diamine |
| SMILES | Cc1c(C)c2[nH]c(N)nc(N)c2c2ccnc12 |
| InChI | InChI=1S/C12H13N5/c1-5-6(2)10-8(7-3-4-15-9(5)7)11(13)17-12(14)16-10/h3-4H,13H2,1-2H3,(H3,14,16,17) |
| InChIKey | OOGDDGNZVPNOES-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |