C10H10N2O4 — CID 135744213
2-[(Z)-C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-hydroxycarbonimidoyl]phenol (PubChem CID 135744213) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-[(Z)-C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-hydroxycarbonimidoyl]phenol.
| Compound Name | 2-[(Z)-C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-hydroxycarbonimidoyl]phenol |
|---|---|
| PubChem CID | 135744213 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-[(Z)-C-(5,6-dihydro-1,4,2-dioxazin-3-yl)-N-hydroxycarbonimidoyl]phenol |
| SMILES | O/N=C(\C1=NOCCO1)c1ccccc1O |
| InChI | InChI=1S/C10H10N2O4/c13-8-4-2-1-3-7(8)9(11-14)10-12-16-6-5-15-10/h1-4,13-14H,5-6H2/b11-9- |
| InChIKey | UTGGLXDYWSTLTJ-LUAWRHEFSA-N |
| XLogP | 0.93 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|