About 4,7-dihydropyrazolo[1,5-a]pyrimidine
4,7-dihydropyrazolo[1,5-a]pyrimidine (PubChem CID 135745164) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is 4,7-dihydropyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 4,7-dihydropyrazolo[1,5-a]pyrimidine |
| PubChem CID | 135745164 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 4,7-dihydropyrazolo[1,5-a]pyrimidine |
| SMILES | C1=CNc2ccnn2C1 |
| InChI | InChI=1S/C6H7N3/c1-3-7-6-2-4-8-9(6)5-1/h1-4,7H,5H2 |
| InChIKey | LSCPRSARMGLOSF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,7-dihydropyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydropyrazolo[1,5-a]pyrimidine?
The IUPAC name of 4,7-dihydropyrazolo[1,5-a]pyrimidine (CID 135745164) is 4,7-dihydropyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 4,7-dihydropyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 4,7-dihydropyrazolo[1,5-a]pyrimidine is C1=CNc2ccnn2C1.
What is the InChIKey of 4,7-dihydropyrazolo[1,5-a]pyrimidine?
The InChIKey is LSCPRSARMGLOSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3/c1-3-7-6-2-4-8-9(6)5-1/h1-4,7H,5H2.
What are the key properties of 4,7-dihydropyrazolo[1,5-a]pyrimidine?
4,7-dihydropyrazolo[1,5-a]pyrimidine has a molecular weight of 121.14 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydropyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 135745164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).