C17H13N5O — CID 135745661
(12Z)-12-(1H-indol-3-ylmethylidene)-1,2,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-2,6,8-trien-11-one (PubChem CID 135745661) has the molecular formula C17H13N5O and a molecular weight of 303.32 g/mol. Its IUPAC name is (12Z)-12-(1H-indol-3-ylmethylidene)-1,2,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-2,6,8-trien-11-one.
| Compound Name | (12Z)-12-(1H-indol-3-ylmethylidene)-1,2,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-2,6,8-trien-11-one |
|---|---|
| PubChem CID | 135745661 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (12Z)-12-(1H-indol-3-ylmethylidene)-1,2,8,10-tetrazatricyclo[7.3.0.03,7]dodeca-2,6,8-trien-11-one |
| SMILES | O=c1[nH]c2nc3c(nn2/c1=C\c1c[nH]c2ccccc12)CCC=3 |
| InChI | InChI=1S/C17H13N5O/c23-16-15(8-10-9-18-12-5-2-1-4-11(10)12)22-17(20-16)19-13-6-3-7-14(13)21-22/h1-2,4-6,8-9,18H,3,7H2,(H,19,20,23)/b15-8- |
| InChIKey | UALRMWSTTQKZAX-NVNXTCNLSA-N |
| XLogP | 0.45 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |