C48H52N4O2 — CID 135746534
10,20-bis(3,5-ditert-butylphenyl)porphyrin-5,15-diol (PubChem CID 135746534) has the molecular formula C48H52N4O2 and a molecular weight of 716.97 g/mol. Its IUPAC name is 10,20-bis(3,5-ditert-butylphenyl)porphyrin-5,15-diol.
| Compound Name | 10,20-bis(3,5-ditert-butylphenyl)porphyrin-5,15-diol |
|---|---|
| PubChem CID | 135746534 |
| Molecular Formula | C48H52N4O2 |
| Molecular Weight | 716.97 g/mol |
| Exact Mass | 716.41 |
| IUPAC Name | 10,20-bis(3,5-ditert-butylphenyl)porphyrin-5,15-diol |
| SMILES | CC(C)(C)c1cc(/C2=C3\C=CC(=N3)/C(O)=C3/C=CC(=N3)/C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)=C3/C=CC(=N3)/C(O)=C3/C=CC2=N3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C48H52N4O2/c1-45(2,3)29-21-27(22-30(25-29)46(4,5)6)41-33-13-17-37(49-33)43(53)39-19-15-35(51-39)42(28-23-31(47(7,8)9)26-32(24-28)48(10,11)12)36-16-20-40(52-36)44(54)38-18-14-34(41)50-38/h13-26,53-54H,1-12H3/b41-33-,41-34-,42-35-,42-36-,43-37+,43-39+,44-38+,44-40+ |
| InChIKey | KEDNEAWPOCOMAA-DZOIGKAZSA-N |
| XLogP | 11.60 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.97 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |