C13H9N5S — CID 135747002
4-methyl-7-phenyl-8-sulfanylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile (PubChem CID 135747002) has the molecular formula C13H9N5S and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-methyl-7-phenyl-8-sulfanylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile.
| Compound Name | 4-methyl-7-phenyl-8-sulfanylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile |
|---|---|
| PubChem CID | 135747002 |
| Molecular Formula | C13H9N5S |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-methyl-7-phenyl-8-sulfanylpyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile |
| SMILES | Cc1c(C#N)nnc2c(S)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C13H9N5S/c1-8-10(7-14)15-16-13-12(19)11(17-18(8)13)9-5-3-2-4-6-9/h2-6,19H,1H3 |
| InChIKey | WNJFPFWGZMJZBR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|