About N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine
N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine (PubChem CID 135747512) has the molecular formula C8H8F3N5
and a molecular weight of 231.18 g/mol. Its IUPAC name is N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine.
Molecular Properties
| Compound Name | N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine |
| PubChem CID | 135747512 |
| Molecular Formula | C8H8F3N5 |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine |
| SMILES | CC/N=C1\N=C(C(F)(F)F)NC2=NC=NC21 |
| InChI | InChI=1S/C8H8F3N5/c1-2-12-5-4-6(14-3-13-4)16-7(15-5)8(9,10)11/h3-4H,2H2,1H3,(H,12,13,14,15,16) |
| InChIKey | AJIZDODRDZLXCD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine?
The IUPAC name of N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine (CID 135747512) is N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine.
What is the SMILES notation for N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine?
The canonical SMILES for N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine is CC/N=C1\N=C(C(F)(F)F)NC2=NC=NC21.
What is the InChIKey of N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine?
The InChIKey is AJIZDODRDZLXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N5/c1-2-12-5-4-6(14-3-13-4)16-7(15-5)8(9,10)11/h3-4H,2H2,1H3,(H,12,13,14,15,16).
What are the key properties of N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine?
N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine has a molecular weight of 231.18 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(trifluoromethyl)-3,5-dihydropurin-6-imine is sourced from PubChem (CID 135747512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).