C11H8N6O5S — CID 135747534
4-[(2,6-dioxo-3,5-dihydropurin-8-yl)diazenyl]benzenesulfonic acid (PubChem CID 135747534) has the molecular formula C11H8N6O5S and a molecular weight of 336.29 g/mol. Its IUPAC name is 4-[(2,6-dioxo-3,5-dihydropurin-8-yl)diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(2,6-dioxo-3,5-dihydropurin-8-yl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135747534 |
| Molecular Formula | C11H8N6O5S |
| Molecular Weight | 336.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 4-[(2,6-dioxo-3,5-dihydropurin-8-yl)diazenyl]benzenesulfonic acid |
| SMILES | O=C1NC(=O)C2N=C(/N=N/c3ccc(S(=O)(=O)O)cc3)N=C2N1 |
| InChI | InChI=1S/C11H8N6O5S/c18-9-7-8(14-11(19)15-9)13-10(12-7)17-16-5-1-3-6(4-2-5)23(20,21)22/h1-4,7H,(H,20,21,22)(H2,12,13,14,15,18,19)/b17-16+ |
| InChIKey | GZPMVCAHCYSTAS-WUKNDPDISA-N |
| XLogP | -0.01 |
| TPSA | 162.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.29 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|