About 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine
4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine (PubChem CID 135747545) has the molecular formula C14H24N6
and a molecular weight of 276.39 g/mol. Its IUPAC name is 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine.
Molecular Properties
| Compound Name | 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine |
| PubChem CID | 135747545 |
| Molecular Formula | C14H24N6 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine |
| SMILES | CCN(CC)CCCC(C)/N=C1\N=CNC2=NC=NC21 |
| InChI | InChI=1S/C14H24N6/c1-4-20(5-2)8-6-7-11(3)19-14-12-13(16-9-15-12)17-10-18-14/h9-12H,4-8H2,1-3H3,(H,15,16,17,18,19) |
| InChIKey | OYBFTNOXTDWJLD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine?
The IUPAC name of 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine (CID 135747545) is 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine.
What is the SMILES notation for 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine?
The canonical SMILES for 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine is CCN(CC)CCCC(C)/N=C1\N=CNC2=NC=NC21.
What is the InChIKey of 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine?
The InChIKey is OYBFTNOXTDWJLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N6/c1-4-20(5-2)8-6-7-11(3)19-14-12-13(16-9-15-12)17-10-18-14/h9-12H,4-8H2,1-3H3,(H,15,16,17,18,19).
What are the key properties of 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine?
4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine has a molecular weight of 276.39 g/mol, XLogP of 1.34, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dihydropurin-6-ylideneamino)-N,N-diethylpentan-1-amine is sourced from PubChem (CID 135747545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).