About N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine
N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine (PubChem CID 135747549) has the molecular formula C16H28N6
and a molecular weight of 304.44 g/mol. Its IUPAC name is N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine.
Molecular Properties
| Compound Name | N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine |
| PubChem CID | 135747549 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine |
| SMILES | CCCCN(CCCC)CCC/N=C1\N=CNC2=NC=NC21 |
| InChI | InChI=1S/C16H28N6/c1-3-5-9-22(10-6-4-2)11-7-8-17-15-14-16(19-12-18-14)21-13-20-15/h12-14H,3-11H2,1-2H3,(H,17,18,19,20,21) |
| InChIKey | KMDFHCHJLBPICR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine?
The IUPAC name of N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine (CID 135747549) is N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine.
What is the SMILES notation for N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine?
The canonical SMILES for N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine is CCCCN(CCCC)CCC/N=C1\N=CNC2=NC=NC21.
What is the InChIKey of N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine?
The InChIKey is KMDFHCHJLBPICR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N6/c1-3-5-9-22(10-6-4-2)11-7-8-17-15-14-16(19-12-18-14)21-13-20-15/h12-14H,3-11H2,1-2H3,(H,17,18,19,20,21).
What are the key properties of N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine?
N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine has a molecular weight of 304.44 g/mol, XLogP of 2.12, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-[3-(3,5-dihydropurin-6-ylideneamino)propyl]butan-1-amine is sourced from PubChem (CID 135747549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).