C5H3IN4O — CID 135747550
8-iodo-1,5-dihydropurin-6-one (PubChem CID 135747550) has the molecular formula C5H3IN4O and a molecular weight of 262.01 g/mol. Its IUPAC name is 8-iodo-1,5-dihydropurin-6-one.
| Compound Name | 8-iodo-1,5-dihydropurin-6-one |
|---|---|
| PubChem CID | 135747550 |
| Molecular Formula | C5H3IN4O |
| Molecular Weight | 262.01 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | 8-iodo-1,5-dihydropurin-6-one |
| SMILES | O=C1NC=NC2=NC(I)=NC12 |
| InChI | InChI=1S/C5H3IN4O/c6-5-9-2-3(10-5)7-1-8-4(2)11/h1-2H,(H,7,8,9,10,11) |
| InChIKey | GLGZVZJFZWSDHR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.01 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|