About 2-amino-8-iodo-1,5-dihydropurin-6-one
2-amino-8-iodo-1,5-dihydropurin-6-one (PubChem CID 135747551) has the molecular formula C5H4IN5O
and a molecular weight of 277.03 g/mol. Its IUPAC name is 2-amino-8-iodo-1,5-dihydropurin-6-one.
Molecular Properties
| Compound Name | 2-amino-8-iodo-1,5-dihydropurin-6-one |
| PubChem CID | 135747551 |
| Molecular Formula | C5H4IN5O |
| Molecular Weight | 277.03 g/mol |
| Exact Mass | 276.95 |
| IUPAC Name | 2-amino-8-iodo-1,5-dihydropurin-6-one |
| SMILES | NC1=NC2=NC(I)=NC2C(=O)N1 |
| InChI | InChI=1S/C5H4IN5O/c6-4-8-1-2(9-4)10-5(7)11-3(1)12/h1H,(H3,7,8,9,10,11,12) |
| InChIKey | BMZKHQGSDZCPHE-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.03 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-8-iodo-1,5-dihydropurin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-iodo-1,5-dihydropurin-6-one?
The IUPAC name of 2-amino-8-iodo-1,5-dihydropurin-6-one (CID 135747551) is 2-amino-8-iodo-1,5-dihydropurin-6-one.
What is the SMILES notation for 2-amino-8-iodo-1,5-dihydropurin-6-one?
The canonical SMILES for 2-amino-8-iodo-1,5-dihydropurin-6-one is NC1=NC2=NC(I)=NC2C(=O)N1.
What is the InChIKey of 2-amino-8-iodo-1,5-dihydropurin-6-one?
The InChIKey is BMZKHQGSDZCPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4IN5O/c6-4-8-1-2(9-4)10-5(7)11-3(1)12/h1H,(H3,7,8,9,10,11,12).
What are the key properties of 2-amino-8-iodo-1,5-dihydropurin-6-one?
2-amino-8-iodo-1,5-dihydropurin-6-one has a molecular weight of 277.03 g/mol, XLogP of -1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-iodo-1,5-dihydropurin-6-one is sourced from PubChem (CID 135747551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).