C16H25Cl3N4O — CID 135748571
7-chloro-2-[2-(diethylamino)ethylimino]-4-methyl-1,3-dihydro-1,4-benzodiazepin-5-one;dihydrochloride (PubChem CID 135748571) has the molecular formula C16H25Cl3N4O and a molecular weight of 395.76 g/mol. Its IUPAC name is 7-chloro-2-[2-(diethylamino)ethylimino]-4-methyl-1,3-dihydro-1,4-benzodiazepin-5-one;dihydrochloride.
| Compound Name | 7-chloro-2-[2-(diethylamino)ethylimino]-4-methyl-1,3-dihydro-1,4-benzodiazepin-5-one;dihydrochloride |
|---|---|
| PubChem CID | 135748571 |
| Molecular Formula | C16H25Cl3N4O |
| Molecular Weight | 395.76 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 7-chloro-2-[2-(diethylamino)ethylimino]-4-methyl-1,3-dihydro-1,4-benzodiazepin-5-one;dihydrochloride |
| SMILES | CCN(CC)CC/N=C1\CN(C)C(=O)c2cc(Cl)ccc2N1.Cl.Cl |
| InChI | InChI=1S/C16H23ClN4O.2ClH/c1-4-21(5-2)9-8-18-15-11-20(3)16(22)13-10-12(17)6-7-14(13)19-15;;/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,18,19);2*1H |
| InChIKey | ZCOYTABKUWKTBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|