C18H12FN5O3S — CID 135748657
6-[(3-fluorophenyl)methylsulfanyl]-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135748657) has the molecular formula C18H12FN5O3S and a molecular weight of 397.39 g/mol. Its IUPAC name is 6-[(3-fluorophenyl)methylsulfanyl]-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[(3-fluorophenyl)methylsulfanyl]-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135748657 |
| Molecular Formula | C18H12FN5O3S |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 6-[(3-fluorophenyl)methylsulfanyl]-1-(4-nitrophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(SCc2cccc(F)c2)nc2c1cnn2-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12FN5O3S/c19-12-3-1-2-11(8-12)10-28-18-21-16-15(17(25)22-18)9-20-23(16)13-4-6-14(7-5-13)24(26)27/h1-9H,10H2,(H,21,22,25) |
| InChIKey | AABPDZYPKUQGDB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|