C22H24ClN3O6S — CID 135749934
5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-[(2-methylsulfonylethylamino)methyl]phenyl]-1,2-oxazole-3-carboxamide (PubChem CID 135749934) has the molecular formula C22H24ClN3O6S and a molecular weight of 493.97 g/mol. Its IUPAC name is 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-[(2-methylsulfonylethylamino)methyl]phenyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-[(2-methylsulfonylethylamino)methyl]phenyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 135749934 |
| Molecular Formula | C22H24ClN3O6S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-[(2-methylsulfonylethylamino)methyl]phenyl]-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(=O)c1noc(-c2cc(Cl)c(O)cc2O)c1-c1ccc(CNCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H24ClN3O6S/c1-3-25-22(29)20-19(21(32-26-20)15-10-16(23)18(28)11-17(15)27)14-6-4-13(5-7-14)12-24-8-9-33(2,30)31/h4-7,10-11,24,27-28H,3,8-9,12H2,1-2H3,(H,25,29) |
| InChIKey | HBZAMKDPZGODPV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 141.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|