C19H15Cl2FN3O2+ — CID 135751064
[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)methyl]azanium (PubChem CID 135751064) has the molecular formula C19H15Cl2FN3O2+ and a molecular weight of 407.25 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)methyl]azanium.
| Compound Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135751064 |
| Molecular Formula | C19H15Cl2FN3O2+ |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-[(4-oxo-3H-[1]benzofuro[3,2-d]pyrimidin-2-yl)methyl]azanium |
| SMILES | C[C@@H]([NH2+]Cc1nc2c(oc3ccccc32)c(=O)[nH]1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H14Cl2FN3O2/c1-9(11-6-14(22)13(21)7-12(11)20)23-8-16-24-17-10-4-2-3-5-15(10)27-18(17)19(26)25-16/h2-7,9,23H,8H2,1H3,(H,24,25,26)/p+1/t9-/m1/s1 |
| InChIKey | QJJOFLWUGMYXRM-SECBINFHSA-O |
| XLogP | 3.94 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|