C18H22N4O3S2 — CID 135752019
S-(2-butylsulfanyl-6-methylpyrimidin-4-yl) N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamothioate (PubChem CID 135752019) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is S-(2-butylsulfanyl-6-methylpyrimidin-4-yl) N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamothioate.
| Compound Name | S-(2-butylsulfanyl-6-methylpyrimidin-4-yl) N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamothioate |
|---|---|
| PubChem CID | 135752019 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | S-(2-butylsulfanyl-6-methylpyrimidin-4-yl) N-[(E)-(2-hydroxy-3-methoxyphenyl)methylideneamino]carbamothioate |
| SMILES | CCCCSc1nc(C)cc(SC(=O)N/N=C/c2cccc(OC)c2O)n1 |
| InChI | InChI=1S/C18H22N4O3S2/c1-4-5-9-26-17-20-12(2)10-15(21-17)27-18(24)22-19-11-13-7-6-8-14(25-3)16(13)23/h6-8,10-11,23H,4-5,9H2,1-3H3,(H,22,24)/b19-11+ |
| InChIKey | XPLAGVONFGAFDR-YBFXNURJSA-N |
| XLogP | 4.23 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|