C30H30N4NiO6+4 — CID 135752302
bis([(Z)-C-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)methylideneamino]carbonimidoyl]oxidanium);nickel(2+) (PubChem CID 135752302) has the molecular formula C30H30N4NiO6+4 and a molecular weight of 601.29 g/mol. Its IUPAC name is bis([(Z)-C-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)methylideneamino]carbonimidoyl]oxidanium);nickel(2+).
| Compound Name | bis([(Z)-C-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)methylideneamino]carbonimidoyl]oxidanium);nickel(2+) |
|---|---|
| PubChem CID | 135752302 |
| Molecular Formula | C30H30N4NiO6+4 |
| Molecular Weight | 601.29 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | bis([(Z)-C-(2-hydroxyphenyl)-N-[(4-methoxyphenyl)methylideneamino]carbonimidoyl]oxidanium);nickel(2+) |
| SMILES | COc1ccc(C=N/N=C(\[OH2+])c2ccccc2O)cc1.COc1ccc(C=N/N=C(\[OH2+])c2ccccc2O)cc1.[Ni+2] |
| InChI | InChI=1S/2C15H14N2O3.Ni/c2*1-20-12-8-6-11(7-9-12)10-16-17-15(19)13-4-2-3-5-14(13)18;/h2*2-10,18H,1H3,(H,17,19);/q;;+2/p+2 |
| InChIKey | PSYJLZDTPCEDQB-UHFFFAOYSA-P |
| XLogP | 3.81 |
| TPSA | 154.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|