C20H26N4O — CID 135752609
5-ethyl-7-heptan-3-yl-2-phenyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135752609) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 5-ethyl-7-heptan-3-yl-2-phenyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 5-ethyl-7-heptan-3-yl-2-phenyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135752609 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 5-ethyl-7-heptan-3-yl-2-phenyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | CCCCC(CC)c1nc(CC)c2c(=O)[nH]c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C20H26N4O/c1-4-7-11-14(5-2)19-21-16(6-3)17-20(25)22-18(23-24(17)19)15-12-9-8-10-13-15/h8-10,12-14H,4-7,11H2,1-3H3,(H,22,23,25) |
| InChIKey | FYJZHYMPFQHGTJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |