C11H14N4O4S — CID 135752745
4-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)butyl acetate (PubChem CID 135752745) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)butyl acetate.
| Compound Name | 4-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)butyl acetate |
|---|---|
| PubChem CID | 135752745 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-(5-amino-2,7-dioxo-6H-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)butyl acetate |
| SMILES | CC(=O)OCCCCn1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H14N4O4S/c1-6(16)19-5-3-2-4-15-8-7(20-11(15)18)9(17)14-10(12)13-8/h2-5H2,1H3,(H3,12,13,14,17) |
| InChIKey | DTYOGSVUQQZNCY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|