C13H12N2O — CID 135753389
2-phenyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one (PubChem CID 135753389) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-phenyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one.
| Compound Name | 2-phenyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135753389 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-phenyl-3,5,6,7-tetrahydrocyclopenta[d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2)nc2c1CCC2 |
| InChI | InChI=1S/C13H12N2O/c16-13-10-7-4-8-11(10)14-12(15-13)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,14,15,16) |
| InChIKey | AGQQOLIHSSZYLE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |