About 6H-pyrrolo[3,2-a]phenanthridin-7-amine
6H-pyrrolo[3,2-a]phenanthridin-7-amine (PubChem CID 135753407) has the molecular formula C15H11N3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 6H-pyrrolo[3,2-a]phenanthridin-7-amine.
Molecular Properties
| Compound Name | 6H-pyrrolo[3,2-a]phenanthridin-7-amine |
| PubChem CID | 135753407 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 6H-pyrrolo[3,2-a]phenanthridin-7-amine |
| SMILES | Nc1[nH]c2ccc3nccc3c2c2ccccc12 |
| InChI | InChI=1S/C15H11N3/c16-15-10-4-2-1-3-9(10)14-11-7-8-17-12(11)5-6-13(14)18-15/h1-8,18H,16H2 |
| InChIKey | VNTHQFIRAICBRD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6H-pyrrolo[3,2-a]phenanthridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrrolo[3,2-a]phenanthridin-7-amine?
The IUPAC name of 6H-pyrrolo[3,2-a]phenanthridin-7-amine (CID 135753407) is 6H-pyrrolo[3,2-a]phenanthridin-7-amine.
What is the SMILES notation for 6H-pyrrolo[3,2-a]phenanthridin-7-amine?
The canonical SMILES for 6H-pyrrolo[3,2-a]phenanthridin-7-amine is Nc1[nH]c2ccc3nccc3c2c2ccccc12.
What is the InChIKey of 6H-pyrrolo[3,2-a]phenanthridin-7-amine?
The InChIKey is VNTHQFIRAICBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3/c16-15-10-4-2-1-3-9(10)14-11-7-8-17-12(11)5-6-13(14)18-15/h1-8,18H,16H2.
What are the key properties of 6H-pyrrolo[3,2-a]phenanthridin-7-amine?
6H-pyrrolo[3,2-a]phenanthridin-7-amine has a molecular weight of 233.27 g/mol, XLogP of 3.45, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrrolo[3,2-a]phenanthridin-7-amine is sourced from PubChem (CID 135753407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).